C16H21N3OS — CID 80715165
2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide (PubChem CID 80715165) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide.
| Compound Name | 2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
|---|---|
| PubChem CID | 80715165 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)-5,6,7,8-tetrahydroquinoline-3-carbothioamide |
| SMILES | NC(=S)c1cc2c(nc1NC1CC3CCC1O3)CCCC2 |
| InChI | InChI=1S/C16H21N3OS/c17-15(21)11-7-9-3-1-2-4-12(9)18-16(11)19-13-8-10-5-6-14(13)20-10/h7,10,13-14H,1-6,8H2,(H2,17,21)(H,18,19) |
| InChIKey | DWVFXHZLGBLZKI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|