About 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide
3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide (PubChem CID 80715634) has the molecular formula C13H14Cl2N2O2
and a molecular weight of 301.17 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
| PubChem CID | 80715634 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide |
| SMILES | Nc1cc(C(=O)NC2CC3CCC2O3)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H14Cl2N2O2/c14-8-3-6(4-9(16)12(8)15)13(18)17-10-5-7-1-2-11(10)19-7/h3-4,7,10-11H,1-2,5,16H2,(H,17,18) |
| InChIKey | YCTYXTNKAZTZFV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide?
The IUPAC name of 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide (CID 80715634) is 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide.
What is the SMILES notation for 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide?
The canonical SMILES for 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide is Nc1cc(C(=O)NC2CC3CCC2O3)cc(Cl)c1Cl.
What is the InChIKey of 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide?
The InChIKey is YCTYXTNKAZTZFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2N2O2/c14-8-3-6(4-9(16)12(8)15)13(18)17-10-5-7-1-2-11(10)19-7/h3-4,7,10-11H,1-2,5,16H2,(H,17,18).
What are the key properties of 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide?
3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide has a molecular weight of 301.17 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5-dichloro-N-(7-oxabicyclo[2.2.1]heptan-2-yl)benzamide is sourced from PubChem (CID 80715634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).