C13H20N2O — CID 80715831
2-methyl-1-(oxolan-3-yl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 80715831) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 2-methyl-1-(oxolan-3-yl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 2-methyl-1-(oxolan-3-yl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 80715831 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-methyl-1-(oxolan-3-yl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | Cc1cc2c(n1C1CCOC1)CCCC2N |
| InChI | InChI=1S/C13H20N2O/c1-9-7-11-12(14)3-2-4-13(11)15(9)10-5-6-16-8-10/h7,10,12H,2-6,8,14H2,1H3 |
| InChIKey | WHAOXBZLZPEWEV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |