C13H14N2O5 — CID 80716181
4-nitro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzoic acid (PubChem CID 80716181) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 4-nitro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzoic acid.
| Compound Name | 4-nitro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 80716181 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 4-nitro-2-(7-oxabicyclo[2.2.1]heptan-2-ylamino)benzoic acid |
| SMILES | O=C(O)c1ccc([N+](=O)[O-])cc1NC1CC2CCC1O2 |
| InChI | InChI=1S/C13H14N2O5/c16-13(17)9-3-1-7(15(18)19)5-10(9)14-11-6-8-2-4-12(11)20-8/h1,3,5,8,11-12,14H,2,4,6H2,(H,16,17) |
| InChIKey | XDWDIZROEKOWPG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|