C9H9ClN6O — CID 80716626
2-amino-6-chloro-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-4-carboxamide (PubChem CID 80716626) has the molecular formula C9H9ClN6O and a molecular weight of 252.66 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 80716626 |
| Molecular Formula | C9H9ClN6O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-amino-6-chloro-N-(2-methyl-1,2,4-triazol-3-yl)pyridine-4-carboxamide |
| SMILES | Cn1ncnc1NC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C9H9ClN6O/c1-16-9(12-4-13-16)15-8(17)5-2-6(10)14-7(11)3-5/h2-4H,1H3,(H2,11,14)(H,12,13,15,17) |
| InChIKey | MMEAUWZMQIUXBY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|