About 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid
2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid (PubChem CID 80717183) has the molecular formula C11H17N3O5S
and a molecular weight of 303.34 g/mol. Its IUPAC name is 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid |
| PubChem CID | 80717183 |
| Molecular Formula | C11H17N3O5S |
| Molecular Weight | 303.34 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid |
| SMILES | Cc1nn(CC(=O)O)c(C)c1S(=O)(=O)NC1CCOC1 |
| InChI | InChI=1S/C11H17N3O5S/c1-7-11(8(2)14(12-7)5-10(15)16)20(17,18)13-9-3-4-19-6-9/h9,13H,3-6H2,1-2H3,(H,15,16) |
| InChIKey | XNUWNWWHKDRHFS-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid?
The IUPAC name of 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid (CID 80717183) is 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid.
What is the SMILES notation for 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid?
The canonical SMILES for 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid is Cc1nn(CC(=O)O)c(C)c1S(=O)(=O)NC1CCOC1.
What is the InChIKey of 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid?
The InChIKey is XNUWNWWHKDRHFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3O5S/c1-7-11(8(2)14(12-7)5-10(15)16)20(17,18)13-9-3-4-19-6-9/h9,13H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid?
2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid has a molecular weight of 303.34 g/mol, XLogP of -0.35, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-dimethyl-4-(oxolan-3-ylsulfamoyl)pyrazol-1-yl]acetic acid is sourced from PubChem (CID 80717183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).