C13H18N2O4S — CID 80717767
N-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(methanesulfonamido)benzamide (PubChem CID 80717767) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 80717767 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-[[1-(hydroxymethyl)cyclopropyl]methyl]-4-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(C(=O)NCC2(CO)CC2)cc1 |
| InChI | InChI=1S/C13H18N2O4S/c1-20(18,19)15-11-4-2-10(3-5-11)12(17)14-8-13(9-16)6-7-13/h2-5,15-16H,6-9H2,1H3,(H,14,17) |
| InChIKey | QPFFUCJIFFKKDT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |