C15H20FNO — CID 80719060
N-cycloheptyl-2-fluoro-3-methylbenzamide (PubChem CID 80719060) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is N-cycloheptyl-2-fluoro-3-methylbenzamide.
| Compound Name | N-cycloheptyl-2-fluoro-3-methylbenzamide |
|---|---|
| PubChem CID | 80719060 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-cycloheptyl-2-fluoro-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC2CCCCCC2)c1F |
| InChI | InChI=1S/C15H20FNO/c1-11-7-6-10-13(14(11)16)15(18)17-12-8-4-2-3-5-9-12/h6-7,10,12H,2-5,8-9H2,1H3,(H,17,18) |
| InChIKey | GQTACWZVMRXTSM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |