C18H31NOS — CID 80719995
N-[[5-methyl-4-(octoxymethyl)thiophen-2-yl]methyl]cyclopropanamine (PubChem CID 80719995) has the molecular formula C18H31NOS and a molecular weight of 309.52 g/mol. Its IUPAC name is N-[[5-methyl-4-(octoxymethyl)thiophen-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[5-methyl-4-(octoxymethyl)thiophen-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 80719995 |
| Molecular Formula | C18H31NOS |
| Molecular Weight | 309.52 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | N-[[5-methyl-4-(octoxymethyl)thiophen-2-yl]methyl]cyclopropanamine |
| SMILES | CCCCCCCCOCc1cc(CNC2CC2)sc1C |
| InChI | InChI=1S/C18H31NOS/c1-3-4-5-6-7-8-11-20-14-16-12-18(21-15(16)2)13-19-17-9-10-17/h12,17,19H,3-11,13-14H2,1-2H3 |
| InChIKey | DVFBAQYFWIYSKK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|