C14H21F4NOS — CID 80720950
2-methyl-N-[[5-methyl-4-(2,2,3,3-tetrafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 80720950) has the molecular formula C14H21F4NOS and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-methyl-N-[[5-methyl-4-(2,2,3,3-tetrafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[5-methyl-4-(2,2,3,3-tetrafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 80720950 |
| Molecular Formula | C14H21F4NOS |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-methyl-N-[[5-methyl-4-(2,2,3,3-tetrafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | Cc1sc(CNC(C)(C)C)cc1COCC(F)(F)C(F)F |
| InChI | InChI=1S/C14H21F4NOS/c1-9-10(7-20-8-14(17,18)12(15)16)5-11(21-9)6-19-13(2,3)4/h5,12,19H,6-8H2,1-4H3 |
| InChIKey | ZJYSLZFIIOAJBT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|