C13H21N3O3 — CID 80721618
N',N'-dimethyl-N-(3-nitro-5-propan-2-yloxyphenyl)ethane-1,2-diamine (PubChem CID 80721618) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is N',N'-dimethyl-N-(3-nitro-5-propan-2-yloxyphenyl)ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-(3-nitro-5-propan-2-yloxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 80721618 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | N',N'-dimethyl-N-(3-nitro-5-propan-2-yloxyphenyl)ethane-1,2-diamine |
| SMILES | CC(C)Oc1cc(NCCN(C)C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H21N3O3/c1-10(2)19-13-8-11(14-5-6-15(3)4)7-12(9-13)16(17)18/h7-10,14H,5-6H2,1-4H3 |
| InChIKey | FZMBBMFAWZNNFF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|