C15H12N2OS3 — CID 80721624
(6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-thieno[3,2-b]thiophen-5-ylmethanone (PubChem CID 80721624) has the molecular formula C15H12N2OS3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-thieno[3,2-b]thiophen-5-ylmethanone.
| Compound Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
|---|---|
| PubChem CID | 80721624 |
| Molecular Formula | C15H12N2OS3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | (6-amino-2,3-dihydro-1,4-benzothiazin-4-yl)-thieno[3,2-b]thiophen-5-ylmethanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)c1cc3sccc3s1)CCS2 |
| InChI | InChI=1S/C15H12N2OS3/c16-9-1-2-11-10(7-9)17(4-6-20-11)15(18)14-8-13-12(21-14)3-5-19-13/h1-3,5,7-8H,4,6,16H2 |
| InChIKey | XCFVPYMQTFYISK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|