C18H23NOS — CID 80721945
N-[[5-methyl-4-[(2-prop-2-enylphenoxy)methyl]thiophen-2-yl]methyl]ethanamine (PubChem CID 80721945) has the molecular formula C18H23NOS and a molecular weight of 301.45 g/mol. Its IUPAC name is N-[[5-methyl-4-[(2-prop-2-enylphenoxy)methyl]thiophen-2-yl]methyl]ethanamine.
| Compound Name | N-[[5-methyl-4-[(2-prop-2-enylphenoxy)methyl]thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 80721945 |
| Molecular Formula | C18H23NOS |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N-[[5-methyl-4-[(2-prop-2-enylphenoxy)methyl]thiophen-2-yl]methyl]ethanamine |
| SMILES | C=CCc1ccccc1OCc1cc(CNCC)sc1C |
| InChI | InChI=1S/C18H23NOS/c1-4-8-15-9-6-7-10-18(15)20-13-16-11-17(12-19-5-2)21-14(16)3/h4,6-7,9-11,19H,1,5,8,12-13H2,2-3H3 |
| InChIKey | REYOCPXBVNDTFR-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|