C11H18N2O — CID 80722151
5-ethoxy-3-N-ethyl-3-N-methylbenzene-1,3-diamine (PubChem CID 80722151) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 5-ethoxy-3-N-ethyl-3-N-methylbenzene-1,3-diamine.
| Compound Name | 5-ethoxy-3-N-ethyl-3-N-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 80722151 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 5-ethoxy-3-N-ethyl-3-N-methylbenzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(N(C)CC)c1 |
| InChI | InChI=1S/C11H18N2O/c1-4-13(3)10-6-9(12)7-11(8-10)14-5-2/h6-8H,4-5,12H2,1-3H3 |
| InChIKey | IVVMWKSBKDQOGZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|