About 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline
4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline (PubChem CID 80722276) has the molecular formula C14H5Cl3N2S2
and a molecular weight of 371.70 g/mol. Its IUPAC name is 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline.
Molecular Properties
| Compound Name | 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline |
| PubChem CID | 80722276 |
| Molecular Formula | C14H5Cl3N2S2 |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline |
| SMILES | Clc1cc(Cl)c2nc(-c3cc4sccc4s3)nc(Cl)c2c1 |
| InChI | InChI=1S/C14H5Cl3N2S2/c15-6-3-7-12(8(16)4-6)18-14(19-13(7)17)11-5-10-9(21-11)1-2-20-10/h1-5H |
| InChIKey | OZERQWWRHOAMHO-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline?
The IUPAC name of 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline (CID 80722276) is 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline.
What is the SMILES notation for 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline?
The canonical SMILES for 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline is Clc1cc(Cl)c2nc(-c3cc4sccc4s3)nc(Cl)c2c1.
What is the InChIKey of 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline?
The InChIKey is OZERQWWRHOAMHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Cl3N2S2/c15-6-3-7-12(8(16)4-6)18-14(19-13(7)17)11-5-10-9(21-11)1-2-20-10/h1-5H.
What are the key properties of 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline?
4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline has a molecular weight of 371.70 g/mol, XLogP of 6.53, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6,8-trichloro-2-thieno[3,2-b]thiophen-5-ylquinazoline is sourced from PubChem (CID 80722276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).