C14H13F3N2O — CID 80722727
5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine (PubChem CID 80722727) has the molecular formula C14H13F3N2O and a molecular weight of 282.27 g/mol. Its IUPAC name is 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 80722727 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-diamine |
| SMILES | COc1cc(N)cc(Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C14H13F3N2O/c1-20-13-7-10(18)6-12(8-13)19-11-4-2-3-9(5-11)14(15,16)17/h2-8,19H,18H2,1H3 |
| InChIKey | QVMGPQPEYURJOH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|