C13H18F5NOS — CID 80723190
N-[[5-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine (PubChem CID 80723190) has the molecular formula C13H18F5NOS and a molecular weight of 331.35 g/mol. Its IUPAC name is N-[[5-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 80723190 |
| Molecular Formula | C13H18F5NOS |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[[5-methyl-4-(2,2,3,3,3-pentafluoropropoxymethyl)thiophen-2-yl]methyl]propan-2-amine |
| SMILES | Cc1sc(CNC(C)C)cc1COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H18F5NOS/c1-8(2)19-5-11-4-10(9(3)21-11)6-20-7-12(14,15)13(16,17)18/h4,8,19H,5-7H2,1-3H3 |
| InChIKey | DOXDYXOUTFPRAT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|