C16H26N2O — CID 80724019
3-N-cyclopentyl-3-N-ethyl-5-propoxybenzene-1,3-diamine (PubChem CID 80724019) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 3-N-cyclopentyl-3-N-ethyl-5-propoxybenzene-1,3-diamine.
| Compound Name | 3-N-cyclopentyl-3-N-ethyl-5-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 80724019 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 3-N-cyclopentyl-3-N-ethyl-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(N(CC)C2CCCC2)c1 |
| InChI | InChI=1S/C16H26N2O/c1-3-9-19-16-11-13(17)10-15(12-16)18(4-2)14-7-5-6-8-14/h10-12,14H,3-9,17H2,1-2H3 |
| InChIKey | PGYHZNLLOQREGW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|