C12H13N3O3S — CID 80724985
3-methoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-5-nitroaniline (PubChem CID 80724985) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-methoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-5-nitroaniline.
| Compound Name | 3-methoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-5-nitroaniline |
|---|---|
| PubChem CID | 80724985 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-methoxy-N-[(4-methyl-1,3-thiazol-5-yl)methyl]-5-nitroaniline |
| SMILES | COc1cc(NCc2scnc2C)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H13N3O3S/c1-8-12(19-7-14-8)6-13-9-3-10(15(16)17)5-11(4-9)18-2/h3-5,7,13H,6H2,1-2H3 |
| InChIKey | FPKXGVMPEGMGAM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|