C16H29N3O2 — CID 80725764
2-nonyl-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione (PubChem CID 80725764) has the molecular formula C16H29N3O2 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-nonyl-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione.
| Compound Name | 2-nonyl-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione |
|---|---|
| PubChem CID | 80725764 |
| Molecular Formula | C16H29N3O2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.23 |
| IUPAC Name | 2-nonyl-1,6,7,8,9,9a-hexahydropyrazino[1,2-a]pyrazine-3,4-dione |
| SMILES | CCCCCCCCCN1CC2CNCCN2C(=O)C1=O |
| InChI | InChI=1S/C16H29N3O2/c1-2-3-4-5-6-7-8-10-18-13-14-12-17-9-11-19(14)16(21)15(18)20/h14,17H,2-13H2,1H3 |
| InChIKey | ZBBKMVVVMYIRTJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|