About N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine
N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 80726505) has the molecular formula C11H11N7
and a molecular weight of 241.26 g/mol. Its IUPAC name is N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 80726505 |
| Molecular Formula | C11H11N7 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CNc1nc(C)nc2c1cnn2-c1ccncn1 |
| InChI | InChI=1S/C11H11N7/c1-7-16-10(12-2)8-5-15-18(11(8)17-7)9-3-4-13-6-14-9/h3-6H,1-2H3,(H,12,16,17) |
| InChIKey | LBNONBPMGGOOBH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine (CID 80726505) is N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine is CNc1nc(C)nc2c1cnn2-c1ccncn1.
What is the InChIKey of N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is LBNONBPMGGOOBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N7/c1-7-16-10(12-2)8-5-15-18(11(8)17-7)9-3-4-13-6-14-9/h3-6H,1-2H3,(H,12,16,17).
What are the key properties of N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine?
N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 241.26 g/mol, XLogP of 0.96, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N,6-dimethyl-1-pyrimidin-4-ylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 80726505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).