About N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine
N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 80726603) has the molecular formula C10H15N5
and a molecular weight of 205.26 g/mol. Its IUPAC name is N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| PubChem CID | 80726603 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | CCNc1nc(C)nc2c1cnn2CC |
| InChI | InChI=1S/C10H15N5/c1-4-11-9-8-6-12-15(5-2)10(8)14-7(3)13-9/h6H,4-5H2,1-3H3,(H,11,13,14) |
| InChIKey | ZHHNKRMUDNGSAC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The IUPAC name of N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine (CID 80726603) is N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine.
What is the SMILES notation for N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The canonical SMILES for N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine is CCNc1nc(C)nc2c1cnn2CC.
What is the InChIKey of N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine?
The InChIKey is ZHHNKRMUDNGSAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5/c1-4-11-9-8-6-12-15(5-2)10(8)14-7(3)13-9/h6H,4-5H2,1-3H3,(H,11,13,14).
What are the key properties of N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine?
N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine has a molecular weight of 205.26 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,1-diethyl-6-methylpyrazolo[3,4-d]pyrimidin-4-amine is sourced from PubChem (CID 80726603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).