C10H11ClF3N3O2 — CID 80726867
4-chloro-2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde (PubChem CID 80726867) has the molecular formula C10H11ClF3N3O2 and a molecular weight of 297.66 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 80726867 |
| Molecular Formula | C10H11ClF3N3O2 |
| Molecular Weight | 297.66 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 4-chloro-2-methyl-6-[2-(2,2,2-trifluoroethoxy)ethylamino]pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NCCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H11ClF3N3O2/c1-6-16-8(11)7(4-18)9(17-6)15-2-3-19-5-10(12,13)14/h4H,2-3,5H2,1H3,(H,15,16,17) |
| InChIKey | OKNKWBVJCIWLRH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.66 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|