C11H18N2S — CID 80728454
N-[[5-(aminomethyl)-2-methylthiophen-3-yl]methyl]-N-methylcyclopropanamine (PubChem CID 80728454) has the molecular formula C11H18N2S and a molecular weight of 210.35 g/mol. Its IUPAC name is N-[[5-(aminomethyl)-2-methylthiophen-3-yl]methyl]-N-methylcyclopropanamine.
| Compound Name | N-[[5-(aminomethyl)-2-methylthiophen-3-yl]methyl]-N-methylcyclopropanamine |
|---|---|
| PubChem CID | 80728454 |
| Molecular Formula | C11H18N2S |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | N-[[5-(aminomethyl)-2-methylthiophen-3-yl]methyl]-N-methylcyclopropanamine |
| SMILES | Cc1sc(CN)cc1CN(C)C1CC1 |
| InChI | InChI=1S/C11H18N2S/c1-8-9(5-11(6-12)14-8)7-13(2)10-3-4-10/h5,10H,3-4,6-7,12H2,1-2H3 |
| InChIKey | QOMBOLCYFSBEQM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |