C12H14F3N3S — CID 80728743
N-methyl-1-[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methanamine (PubChem CID 80728743) has the molecular formula C12H14F3N3S and a molecular weight of 289.33 g/mol. Its IUPAC name is N-methyl-1-[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methanamine.
| Compound Name | N-methyl-1-[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 80728743 |
| Molecular Formula | C12H14F3N3S |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-methyl-1-[5-methyl-4-[[3-(trifluoromethyl)pyrazol-1-yl]methyl]thiophen-2-yl]methanamine |
| SMILES | CNCc1cc(Cn2ccc(C(F)(F)F)n2)c(C)s1 |
| InChI | InChI=1S/C12H14F3N3S/c1-8-9(5-10(19-8)6-16-2)7-18-4-3-11(17-18)12(13,14)15/h3-5,16H,6-7H2,1-2H3 |
| InChIKey | WLXLUWRWHUZKOD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |