C15H25N3S — CID 80729106
[5-methyl-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiophen-2-yl]methanamine (PubChem CID 80729106) has the molecular formula C15H25N3S and a molecular weight of 279.45 g/mol. Its IUPAC name is [5-methyl-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiophen-2-yl]methanamine.
| Compound Name | [5-methyl-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiophen-2-yl]methanamine |
|---|---|
| PubChem CID | 80729106 |
| Molecular Formula | C15H25N3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | [5-methyl-4-[(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]thiophen-2-yl]methanamine |
| SMILES | Cc1sc(CN)cc1CN1CC2CCCN2CC1C |
| InChI | InChI=1S/C15H25N3S/c1-11-8-17-5-3-4-14(17)10-18(11)9-13-6-15(7-16)19-12(13)2/h6,11,14H,3-5,7-10,16H2,1-2H3 |
| InChIKey | TYNLSAXSYIOBDR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |