C15H22BrN3S — CID 80729108
N-[[4-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-5-methylthiophen-2-yl]methyl]propan-1-amine (PubChem CID 80729108) has the molecular formula C15H22BrN3S and a molecular weight of 356.33 g/mol. Its IUPAC name is N-[[4-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-5-methylthiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[4-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-5-methylthiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80729108 |
| Molecular Formula | C15H22BrN3S |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | N-[[4-[(4-bromo-3,5-dimethylpyrazol-1-yl)methyl]-5-methylthiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(Cn2nc(C)c(Br)c2C)c(C)s1 |
| InChI | InChI=1S/C15H22BrN3S/c1-5-6-17-8-14-7-13(12(4)20-14)9-19-11(3)15(16)10(2)18-19/h7,17H,5-6,8-9H2,1-4H3 |
| InChIKey | XPGVAVLAYRLIGR-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|