About [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine
[5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine (PubChem CID 80729759) has the molecular formula C9H12N4S
and a molecular weight of 208.29 g/mol. Its IUPAC name is [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine.
Molecular Properties
| Compound Name | [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine |
| PubChem CID | 80729759 |
| Molecular Formula | C9H12N4S |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine |
| SMILES | Cc1sc(CN)cc1Cn1cncn1 |
| InChI | InChI=1S/C9H12N4S/c1-7-8(2-9(3-10)14-7)4-13-6-11-5-12-13/h2,5-6H,3-4,10H2,1H3 |
| InChIKey | CJNPYFACIHDZJU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine?
The IUPAC name of [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine (CID 80729759) is [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine.
What is the SMILES notation for [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine?
The canonical SMILES for [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine is Cc1sc(CN)cc1Cn1cncn1.
What is the InChIKey of [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine?
The InChIKey is CJNPYFACIHDZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S/c1-7-8(2-9(3-10)14-7)4-13-6-11-5-12-13/h2,5-6H,3-4,10H2,1H3.
What are the key properties of [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine?
[5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine has a molecular weight of 208.29 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-methyl-4-(1,2,4-triazol-1-ylmethyl)thiophen-2-yl]methanamine is sourced from PubChem (CID 80729759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).