C14H22N2O2S — CID 80731030
2-[(2-methylthiolan-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 80731030) has the molecular formula C14H22N2O2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 2-[(2-methylthiolan-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 2-[(2-methylthiolan-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 80731030 |
| Molecular Formula | C14H22N2O2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-[(2-methylthiolan-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | CC1(CN2CCC(=O)N3CCCC3C2=O)CCCS1 |
| InChI | InChI=1S/C14H22N2O2S/c1-14(6-3-9-19-14)10-15-8-5-12(17)16-7-2-4-11(16)13(15)18/h11H,2-10H2,1H3 |
| InChIKey | YWZGNHAYHDLAPL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |