About 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde
4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde (PubChem CID 80732572) has the molecular formula C14H14ClN3OS
and a molecular weight of 307.81 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde |
| PubChem CID | 80732572 |
| Molecular Formula | C14H14ClN3OS |
| Molecular Weight | 307.81 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(N2CCc3sccc3C2C)n1 |
| InChI | InChI=1S/C14H14ClN3OS/c1-8-10-4-6-20-12(10)3-5-18(8)14-11(7-19)13(15)16-9(2)17-14/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | HQZBWEQMLWLRIV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde?
The IUPAC name of 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde (CID 80732572) is 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde?
The canonical SMILES for 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde is Cc1nc(Cl)c(C=O)c(N2CCc3sccc3C2C)n1.
What is the InChIKey of 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde?
The InChIKey is HQZBWEQMLWLRIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3OS/c1-8-10-4-6-20-12(10)3-5-18(8)14-11(7-19)13(15)16-9(2)17-14/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde?
4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde has a molecular weight of 307.81 g/mol, XLogP of 3.44, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-methyl-6-(4-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)pyrimidine-5-carbaldehyde is sourced from PubChem (CID 80732572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).