C15H19NS2 — CID 80733814
N-[cyclopenten-1-yl(thieno[3,2-b]thiophen-5-yl)methyl]propan-1-amine (PubChem CID 80733814) has the molecular formula C15H19NS2 and a molecular weight of 277.46 g/mol. Its IUPAC name is N-[cyclopenten-1-yl(thieno[3,2-b]thiophen-5-yl)methyl]propan-1-amine.
| Compound Name | N-[cyclopenten-1-yl(thieno[3,2-b]thiophen-5-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 80733814 |
| Molecular Formula | C15H19NS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-[cyclopenten-1-yl(thieno[3,2-b]thiophen-5-yl)methyl]propan-1-amine |
| SMILES | CCCNC(C1=CCCC1)c1cc2sccc2s1 |
| InChI | InChI=1S/C15H19NS2/c1-2-8-16-15(11-5-3-4-6-11)14-10-13-12(18-14)7-9-17-13/h5,7,9-10,15-16H,2-4,6,8H2,1H3 |
| InChIKey | CDJQSPXRTUAWEQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|