C13H20F3NOS — CID 80734065
N-[[5-methyl-4-(1,1,1-trifluoropropan-2-yloxymethyl)thiophen-2-yl]methyl]propan-1-amine (PubChem CID 80734065) has the molecular formula C13H20F3NOS and a molecular weight of 295.37 g/mol. Its IUPAC name is N-[[5-methyl-4-(1,1,1-trifluoropropan-2-yloxymethyl)thiophen-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-methyl-4-(1,1,1-trifluoropropan-2-yloxymethyl)thiophen-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 80734065 |
| Molecular Formula | C13H20F3NOS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-[[5-methyl-4-(1,1,1-trifluoropropan-2-yloxymethyl)thiophen-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(COC(C)C(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C13H20F3NOS/c1-4-5-17-7-12-6-11(9(2)19-12)8-18-10(3)13(14,15)16/h6,10,17H,4-5,7-8H2,1-3H3 |
| InChIKey | CRBVQEPTGXDTPB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|