C13H22N4O2S — CID 80734175
2-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methyl-methylamino]-N-propylacetamide (PubChem CID 80734175) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methyl-methylamino]-N-propylacetamide.
| Compound Name | 2-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methyl-methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 80734175 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[[5-(hydrazinecarbonyl)-2-methylthiophen-3-yl]methyl-methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CN(C)Cc1cc(C(=O)NN)sc1C |
| InChI | InChI=1S/C13H22N4O2S/c1-4-5-15-12(18)8-17(3)7-10-6-11(13(19)16-14)20-9(10)2/h6H,4-5,7-8,14H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | AMMDRUYRJWBECL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|