About 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine
3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine (PubChem CID 80735039) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine |
| PubChem CID | 80735039 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCc2cnc[nH]2)c1 |
| InChI | InChI=1S/C13H18N4O/c1-2-3-18-13-5-10(14)4-11(6-13)16-8-12-7-15-9-17-12/h4-7,9,16H,2-3,8,14H2,1H3,(H,15,17) |
| InChIKey | YTAKHDQWSKSOKY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine?
The IUPAC name of 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine (CID 80735039) is 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine.
What is the SMILES notation for 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine?
The canonical SMILES for 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine is CCCOc1cc(N)cc(NCc2cnc[nH]2)c1.
What is the InChIKey of 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine?
The InChIKey is YTAKHDQWSKSOKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-2-3-18-13-5-10(14)4-11(6-13)16-8-12-7-15-9-17-12/h4-7,9,16H,2-3,8,14H2,1H3,(H,15,17).
What are the key properties of 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine?
3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine has a molecular weight of 246.31 g/mol, XLogP of 2.39, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(1H-imidazol-5-ylmethyl)-5-propoxybenzene-1,3-diamine is sourced from PubChem (CID 80735039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).