C10H5Br2ClN2O4S2 — CID 80735740
5-chloro-N-(2,5-dibromophenyl)-4-nitrothiophene-2-sulfonamide (PubChem CID 80735740) has the molecular formula C10H5Br2ClN2O4S2 and a molecular weight of 476.56 g/mol. Its IUPAC name is 5-chloro-N-(2,5-dibromophenyl)-4-nitrothiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,5-dibromophenyl)-4-nitrothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 80735740 |
| Molecular Formula | C10H5Br2ClN2O4S2 |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 473.77 |
| IUPAC Name | 5-chloro-N-(2,5-dibromophenyl)-4-nitrothiophene-2-sulfonamide |
| SMILES | O=[N+]([O-])c1cc(S(=O)(=O)Nc2cc(Br)ccc2Br)sc1Cl |
| InChI | InChI=1S/C10H5Br2ClN2O4S2/c11-5-1-2-6(12)7(3-5)14-21(18,19)9-4-8(15(16)17)10(13)20-9/h1-4,14H |
| InChIKey | GEUWXWVBUDNZNL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|