About 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine
3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine (PubChem CID 80738185) has the molecular formula C15H24N2O
and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine |
| PubChem CID | 80738185 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(NC2CCCC2(C)C)c1 |
| InChI | InChI=1S/C15H24N2O/c1-4-18-13-9-11(16)8-12(10-13)17-14-6-5-7-15(14,2)3/h8-10,14,17H,4-7,16H2,1-3H3 |
| InChIKey | VESTWWUQNPNXLS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine?
The IUPAC name of 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine (CID 80738185) is 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine.
What is the SMILES notation for 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine?
The canonical SMILES for 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine is CCOc1cc(N)cc(NC2CCCC2(C)C)c1.
What is the InChIKey of 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine?
The InChIKey is VESTWWUQNPNXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O/c1-4-18-13-9-11(16)8-12(10-13)17-14-6-5-7-15(14,2)3/h8-10,14,17H,4-7,16H2,1-3H3.
What are the key properties of 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine?
3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine has a molecular weight of 248.37 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-(2,2-dimethylcyclopentyl)-5-ethoxybenzene-1,3-diamine is sourced from PubChem (CID 80738185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).