C15H18N2O — CID 80738542
5-methoxy-3-N-methyl-3-N-(3-methylphenyl)benzene-1,3-diamine (PubChem CID 80738542) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 5-methoxy-3-N-methyl-3-N-(3-methylphenyl)benzene-1,3-diamine.
| Compound Name | 5-methoxy-3-N-methyl-3-N-(3-methylphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80738542 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 5-methoxy-3-N-methyl-3-N-(3-methylphenyl)benzene-1,3-diamine |
| SMILES | COc1cc(N)cc(N(C)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C15H18N2O/c1-11-5-4-6-13(7-11)17(2)14-8-12(16)9-15(10-14)18-3/h4-10H,16H2,1-3H3 |
| InChIKey | CQQIEXSSGVWQJT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|