About 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene
5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene (PubChem CID 80739039) has the molecular formula C17H11BrS2
and a molecular weight of 359.31 g/mol. Its IUPAC name is 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene |
| PubChem CID | 80739039 |
| Molecular Formula | C17H11BrS2 |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 357.95 |
| IUPAC Name | 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene |
| SMILES | BrC(c1cc2sccc2s1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H11BrS2/c18-17(16-10-15-14(20-16)8-9-19-15)13-7-3-5-11-4-1-2-6-12(11)13/h1-10,17H |
| InChIKey | OPXJFBCIYMQSNH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene?
The IUPAC name of 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene (CID 80739039) is 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene.
What is the SMILES notation for 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene?
The canonical SMILES for 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene is BrC(c1cc2sccc2s1)c1cccc2ccccc12.
What is the InChIKey of 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene?
The InChIKey is OPXJFBCIYMQSNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BrS2/c18-17(16-10-15-14(20-16)8-9-19-15)13-7-3-5-11-4-1-2-6-12(11)13/h1-10,17H.
What are the key properties of 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene?
5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene has a molecular weight of 359.31 g/mol, XLogP of 6.60, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[bromo(naphthalen-1-yl)methyl]thieno[3,2-b]thiophene is sourced from PubChem (CID 80739039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).