About 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine
4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine (PubChem CID 80739254) has the molecular formula C14H12BrNS2
and a molecular weight of 338.30 g/mol. Its IUPAC name is 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine.
Molecular Properties
| Compound Name | 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine |
| PubChem CID | 80739254 |
| Molecular Formula | C14H12BrNS2 |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine |
| SMILES | CC(c1ccncc1)C(Br)c1cc2sccc2s1 |
| InChI | InChI=1S/C14H12BrNS2/c1-9(10-2-5-16-6-3-10)14(15)13-8-12-11(18-13)4-7-17-12/h2-9,14H,1H3 |
| InChIKey | UCDQJYCMLLHELJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine?
The IUPAC name of 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine (CID 80739254) is 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine.
What is the SMILES notation for 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine?
The canonical SMILES for 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine is CC(c1ccncc1)C(Br)c1cc2sccc2s1.
What is the InChIKey of 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine?
The InChIKey is UCDQJYCMLLHELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12BrNS2/c1-9(10-2-5-16-6-3-10)14(15)13-8-12-11(18-13)4-7-17-12/h2-9,14H,1H3.
What are the key properties of 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine?
4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine has a molecular weight of 338.30 g/mol, XLogP of 5.60, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-bromo-1-thieno[3,2-b]thiophen-5-ylpropan-2-yl)pyridine is sourced from PubChem (CID 80739254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).