C17H20N2O — CID 80739514
3-(1,3-dihydroisoindol-2-yl)-5-propoxyaniline (PubChem CID 80739514) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(1,3-dihydroisoindol-2-yl)-5-propoxyaniline.
| Compound Name | 3-(1,3-dihydroisoindol-2-yl)-5-propoxyaniline |
|---|---|
| PubChem CID | 80739514 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-(1,3-dihydroisoindol-2-yl)-5-propoxyaniline |
| SMILES | CCCOc1cc(N)cc(N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C17H20N2O/c1-2-7-20-17-9-15(18)8-16(10-17)19-11-13-5-3-4-6-14(13)12-19/h3-6,8-10H,2,7,11-12,18H2,1H3 |
| InChIKey | ARLOJPJPWHVTOD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|