About (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine
(5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine (PubChem CID 80740070) has the molecular formula C10H8N2OS2
and a molecular weight of 236.32 g/mol. Its IUPAC name is (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine.
Molecular Properties
| Compound Name | (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine |
| PubChem CID | 80740070 |
| Molecular Formula | C10H8N2OS2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine |
| SMILES | NCc1ncc(-c2cc3sccc3s2)o1 |
| InChI | InChI=1S/C10H8N2OS2/c11-4-10-12-5-6(13-10)8-3-9-7(15-8)1-2-14-9/h1-3,5H,4,11H2 |
| InChIKey | NGTHIEJBGIJJDY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine?
The IUPAC name of (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine (CID 80740070) is (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine.
What is the SMILES notation for (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine?
The canonical SMILES for (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine is NCc1ncc(-c2cc3sccc3s2)o1.
What is the InChIKey of (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine?
The InChIKey is NGTHIEJBGIJJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2OS2/c11-4-10-12-5-6(13-10)8-3-9-7(15-8)1-2-14-9/h1-3,5H,4,11H2.
What are the key properties of (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine?
(5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine has a molecular weight of 236.32 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-thieno[3,2-b]thiophen-5-yl-1,3-oxazol-2-yl)methanamine is sourced from PubChem (CID 80740070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).