C15H9ClN2S3 — CID 80740204
2-[chloro(phenyl)methyl]-5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazole (PubChem CID 80740204) has the molecular formula C15H9ClN2S3 and a molecular weight of 348.91 g/mol. Its IUPAC name is 2-[chloro(phenyl)methyl]-5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazole.
| Compound Name | 2-[chloro(phenyl)methyl]-5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80740204 |
| Molecular Formula | C15H9ClN2S3 |
| Molecular Weight | 348.91 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 2-[chloro(phenyl)methyl]-5-thieno[3,2-b]thiophen-5-yl-1,3,4-thiadiazole |
| SMILES | ClC(c1ccccc1)c1nnc(-c2cc3sccc3s2)s1 |
| InChI | InChI=1S/C15H9ClN2S3/c16-13(9-4-2-1-3-5-9)15-18-17-14(21-15)12-8-11-10(20-12)6-7-19-11/h1-8,13H |
| InChIKey | RXFXOEBRHGXHBF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.91 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|