C15H21NO3 — CID 80740881
2-(2-hydroxyphenyl)-1-[2-(3-hydroxypropyl)pyrrolidin-1-yl]ethanone (PubChem CID 80740881) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-(2-hydroxyphenyl)-1-[2-(3-hydroxypropyl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(2-hydroxyphenyl)-1-[2-(3-hydroxypropyl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 80740881 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-(2-hydroxyphenyl)-1-[2-(3-hydroxypropyl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1O)N1CCCC1CCCO |
| InChI | InChI=1S/C15H21NO3/c17-10-4-7-13-6-3-9-16(13)15(19)11-12-5-1-2-8-14(12)18/h1-2,5,8,13,17-18H,3-4,6-7,9-11H2 |
| InChIKey | OKNQSVOEPFNRBB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |