C13H9FOS2 — CID 80745407
(4-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol (PubChem CID 80745407) has the molecular formula C13H9FOS2 and a molecular weight of 264.35 g/mol. Its IUPAC name is (4-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol.
| Compound Name | (4-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
|---|---|
| PubChem CID | 80745407 |
| Molecular Formula | C13H9FOS2 |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.01 |
| IUPAC Name | (4-fluorophenyl)-thieno[3,2-b]thiophen-5-ylmethanol |
| SMILES | OC(c1ccc(F)cc1)c1cc2sccc2s1 |
| InChI | InChI=1S/C13H9FOS2/c14-9-3-1-8(2-4-9)13(15)12-7-11-10(17-12)5-6-16-11/h1-7,13,15H |
| InChIKey | WGPNBIUPXASUMI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |