C15H12O2S2 — CID 80745674
2-(3-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylethanone (PubChem CID 80745674) has the molecular formula C15H12O2S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylethanone.
| Compound Name | 2-(3-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylethanone |
|---|---|
| PubChem CID | 80745674 |
| Molecular Formula | C15H12O2S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 2-(3-methoxyphenyl)-1-thieno[3,2-b]thiophen-5-ylethanone |
| SMILES | COc1cccc(CC(=O)c2cc3sccc3s2)c1 |
| InChI | InChI=1S/C15H12O2S2/c1-17-11-4-2-3-10(7-11)8-12(16)14-9-15-13(19-14)5-6-18-15/h2-7,9H,8H2,1H3 |
| InChIKey | DHZWADKXFCQVOD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |