About 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one
5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one (PubChem CID 80746315) has the molecular formula C10H15ClN4O
and a molecular weight of 242.71 g/mol. Its IUPAC name is 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one |
| PubChem CID | 80746315 |
| Molecular Formula | C10H15ClN4O |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one |
| SMILES | CC1(C)CNCCN1c1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C10H15ClN4O/c1-10(2)6-12-3-4-15(10)7-5-13-14-9(16)8(7)11/h5,12H,3-4,6H2,1-2H3,(H,14,16) |
| InChIKey | IVKHFKCMMXKQSN-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one?
The IUPAC name of 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one (CID 80746315) is 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one.
What is the SMILES notation for 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one?
The canonical SMILES for 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one is CC1(C)CNCCN1c1cn[nH]c(=O)c1Cl.
What is the InChIKey of 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one?
The InChIKey is IVKHFKCMMXKQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN4O/c1-10(2)6-12-3-4-15(10)7-5-13-14-9(16)8(7)11/h5,12H,3-4,6H2,1-2H3,(H,14,16).
What are the key properties of 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one?
5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one has a molecular weight of 242.71 g/mol, XLogP of 0.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(2,2-dimethylpiperazin-1-yl)-1H-pyridazin-6-one is sourced from PubChem (CID 80746315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).