C12H15F4NO2 — CID 80748935
3-propan-2-yloxy-5-(2,2,3,3-tetrafluoropropoxy)aniline (PubChem CID 80748935) has the molecular formula C12H15F4NO2 and a molecular weight of 281.25 g/mol. Its IUPAC name is 3-propan-2-yloxy-5-(2,2,3,3-tetrafluoropropoxy)aniline.
| Compound Name | 3-propan-2-yloxy-5-(2,2,3,3-tetrafluoropropoxy)aniline |
|---|---|
| PubChem CID | 80748935 |
| Molecular Formula | C12H15F4NO2 |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 3-propan-2-yloxy-5-(2,2,3,3-tetrafluoropropoxy)aniline |
| SMILES | CC(C)Oc1cc(N)cc(OCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C12H15F4NO2/c1-7(2)19-10-4-8(17)3-9(5-10)18-6-12(15,16)11(13)14/h3-5,7,11H,6,17H2,1-2H3 |
| InChIKey | MQGPDMXDMVONNY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|