C12H16N2O5S — CID 80748969
(2R)-3-hydroxy-2-[4-(thiophene-2-carbonylamino)butanoylamino]propanoic acid (PubChem CID 80748969) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[4-(thiophene-2-carbonylamino)butanoylamino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[4-(thiophene-2-carbonylamino)butanoylamino]propanoic acid |
|---|---|
| PubChem CID | 80748969 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | (2R)-3-hydroxy-2-[4-(thiophene-2-carbonylamino)butanoylamino]propanoic acid |
| SMILES | O=C(CCCNC(=O)c1cccs1)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C12H16N2O5S/c15-7-8(12(18)19)14-10(16)4-1-5-13-11(17)9-3-2-6-20-9/h2-3,6,8,15H,1,4-5,7H2,(H,13,17)(H,14,16)(H,18,19)/t8-/m1/s1 |
| InChIKey | HFIVXNWJDOWJID-MRVPVSSYSA-N |
| XLogP | -0.18 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|