About 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine
3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine (PubChem CID 80751437) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine |
| PubChem CID | 80751437 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine |
| SMILES | CCNc1cccc(N(CC)C2CCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O2/c1-3-17-14-11-8-12-15(16(14)19(20)21)18(4-2)13-9-6-5-7-10-13/h8,11-13,17H,3-7,9-10H2,1-2H3 |
| InChIKey | FEECJUFNZMLGGF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine?
The IUPAC name of 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine (CID 80751437) is 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine.
What is the SMILES notation for 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine?
The canonical SMILES for 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine is CCNc1cccc(N(CC)C2CCCCC2)c1[N+](=O)[O-].
What is the InChIKey of 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine?
The InChIKey is FEECJUFNZMLGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-3-17-14-11-8-12-15(16(14)19(20)21)18(4-2)13-9-6-5-7-10-13/h8,11-13,17H,3-7,9-10H2,1-2H3.
What are the key properties of 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine?
3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine has a molecular weight of 291.39 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-cyclohexyl-1-N,3-N-diethyl-2-nitrobenzene-1,3-diamine is sourced from PubChem (CID 80751437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).