About 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine
3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine (PubChem CID 807523) has the molecular formula C18H23NO
and a molecular weight of 269.39 g/mol. Its IUPAC name is 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine.
Molecular Properties
| Compound Name | 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine |
| PubChem CID | 807523 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine |
| SMILES | COC(CCN(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-19(2)15-14-18(20-3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | DKZKNEZEUIHBKX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine?
The IUPAC name of 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine (CID 807523) is 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine.
What is the SMILES notation for 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine?
The canonical SMILES for 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine is COC(CCN(C)C)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine?
The InChIKey is DKZKNEZEUIHBKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO/c1-19(2)15-14-18(20-3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3.
What are the key properties of 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine?
3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine has a molecular weight of 269.39 g/mol, XLogP of 3.53, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N,N-dimethyl-3,3-diphenylpropan-1-amine is sourced from PubChem (CID 807523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).